α-phenylbenzeneacetyl chloride


Product name: α-phenylbenzeneacetyl chloride

CAS NO: 1871-76-7

EC NO: 217-493-5

Type: Intermediate

Standard: Enterprise standard

Assay: ≥99%

Physical and chemical properties:

Structural formula:

Molecular formula: C14H11ClO

Molecular weight: 230.6895

InChI: InChI=1/C14H11ClO/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H

Uses: Pharmaceuticals, Pesticide Intermediates

Packing: 25kg

Storage: Keep away from light, kept in cool and dry place.





  Previous product: Ethyl-2,6-Dichloro-5-Fluoro Pyridine-3-Acetoacetate
  Next product: Methyl diphenylacetate